C20H19N7O3S — CID 4966872
N-(4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl)-2-[1-(4-methylphenyl)tetrazol-5-yl]sulfanylacetamide (PubChem CID 4966872) has the molecular formula C20H19N7O3S and a molecular weight of 437.49 g/mol. Its IUPAC name is N-(4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl)-2-[1-(4-methylphenyl)tetrazol-5-yl]sulfanylacetamide.
| Compound Name | N-(4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl)-2-[1-(4-methylphenyl)tetrazol-5-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 4966872 |
| Molecular Formula | C20H19N7O3S |
| Molecular Weight | 437.49 g/mol |
| Exact Mass | 437.13 |
| IUPAC Name | N-(4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl)-2-[1-(4-methylphenyl)tetrazol-5-yl]sulfanylacetamide |
| SMILES | Cc1ccc(-n2nnnc2SCC(=O)NN2C(=O)NC(C)(c3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C20H19N7O3S/c1-13-8-10-15(11-9-13)26-19(22-24-25-26)31-12-16(28)23-27-17(29)20(2,21-18(27)30)14-6-4-3-5-7-14/h3-11H,12H2,1-2H3,(H,21,30)(H,23,28) |
| InChIKey | SQSOGMBZQZZZSD-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 122.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.49 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|