C16H23N5S — CID 4968180
N-(2-bicyclo[2.2.1]heptanyl)-4-pyrimidin-2-ylpiperazine-1-carbothioamide (PubChem CID 4968180) has the molecular formula C16H23N5S and a molecular weight of 317.46 g/mol. Its IUPAC name is N-(2-bicyclo[2.2.1]heptanyl)-4-pyrimidin-2-ylpiperazine-1-carbothioamide.
| Compound Name | N-(2-bicyclo[2.2.1]heptanyl)-4-pyrimidin-2-ylpiperazine-1-carbothioamide |
|---|---|
| PubChem CID | 4968180 |
| Molecular Formula | C16H23N5S |
| Molecular Weight | 317.46 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | N-(2-bicyclo[2.2.1]heptanyl)-4-pyrimidin-2-ylpiperazine-1-carbothioamide |
| SMILES | S=C(NC1CC2CCC1C2)N1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C16H23N5S/c22-16(19-14-11-12-2-3-13(14)10-12)21-8-6-20(7-9-21)15-17-4-1-5-18-15/h1,4-5,12-14H,2-3,6-11H2,(H,19,22) |
| InChIKey | FSRZQVBKGFMZNG-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.46 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|