C22H22N2O4 — CID 4972776
N-[4-(6,7,10-trimethyl-8-oxo-2,4-dihydropyrano[3,2-g][1,3]benzoxazin-3-yl)phenyl]acetamide (PubChem CID 4972776) has the molecular formula C22H22N2O4 and a molecular weight of 378.43 g/mol. Its IUPAC name is N-[4-(6,7,10-trimethyl-8-oxo-2,4-dihydropyrano[3,2-g][1,3]benzoxazin-3-yl)phenyl]acetamide.
| Compound Name | N-[4-(6,7,10-trimethyl-8-oxo-2,4-dihydropyrano[3,2-g][1,3]benzoxazin-3-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 4972776 |
| Molecular Formula | C22H22N2O4 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | N-[4-(6,7,10-trimethyl-8-oxo-2,4-dihydropyrano[3,2-g][1,3]benzoxazin-3-yl)phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(N2COc3c(cc4c(C)c(C)c(=O)oc4c3C)C2)cc1 |
| InChI | InChI=1S/C22H22N2O4/c1-12-13(2)22(26)28-21-14(3)20-16(9-19(12)21)10-24(11-27-20)18-7-5-17(6-8-18)23-15(4)25/h5-9H,10-11H2,1-4H3,(H,23,25) |
| InChIKey | ZXLMAXOMYLHKHF-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|