C19H13FN4O3S2 — CID 4974042
N-(2,1,3-benzoxadiazol-4-yl)-3-[5-[(2-fluorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanamide (PubChem CID 4974042) has the molecular formula C19H13FN4O3S2 and a molecular weight of 428.47 g/mol. Its IUPAC name is N-(2,1,3-benzoxadiazol-4-yl)-3-[5-[(2-fluorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanamide.
| Compound Name | N-(2,1,3-benzoxadiazol-4-yl)-3-[5-[(2-fluorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanamide |
|---|---|
| PubChem CID | 4974042 |
| Molecular Formula | C19H13FN4O3S2 |
| Molecular Weight | 428.47 g/mol |
| Exact Mass | 428.04 |
| IUPAC Name | N-(2,1,3-benzoxadiazol-4-yl)-3-[5-[(2-fluorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanamide |
| SMILES | O=C(CCN1C(=O)C(=Cc2ccccc2F)SC1=S)Nc1cccc2nonc12 |
| InChI | InChI=1S/C19H13FN4O3S2/c20-12-5-2-1-4-11(12)10-15-18(26)24(19(28)29-15)9-8-16(25)21-13-6-3-7-14-17(13)23-27-22-14/h1-7,10H,8-9H2,(H,21,25) |
| InChIKey | YDZBDTMNUUMEPM-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 88.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.47 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|