C17H13BrINO3 — CID 4974098
6-bromo-N-(4-iodo-2-methylphenyl)-1-oxo-3,4-dihydroisochromene-3-carboxamide (PubChem CID 4974098) has the molecular formula C17H13BrINO3 and a molecular weight of 486.10 g/mol. Its IUPAC name is 6-bromo-N-(4-iodo-2-methylphenyl)-1-oxo-3,4-dihydroisochromene-3-carboxamide.
| Compound Name | 6-bromo-N-(4-iodo-2-methylphenyl)-1-oxo-3,4-dihydroisochromene-3-carboxamide |
|---|---|
| PubChem CID | 4974098 |
| Molecular Formula | C17H13BrINO3 |
| Molecular Weight | 486.10 g/mol |
| Exact Mass | 484.91 |
| IUPAC Name | 6-bromo-N-(4-iodo-2-methylphenyl)-1-oxo-3,4-dihydroisochromene-3-carboxamide |
| SMILES | Cc1cc(I)ccc1NC(=O)C1Cc2cc(Br)ccc2C(=O)O1 |
| InChI | InChI=1S/C17H13BrINO3/c1-9-6-12(19)3-5-14(9)20-16(21)15-8-10-7-11(18)2-4-13(10)17(22)23-15/h2-7,15H,8H2,1H3,(H,20,21) |
| InChIKey | WUZHSAUAFGAHFK-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.10 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|