C21H15ClFNO2 — CID 4974515
5-chloro-6'-(4-fluorobenzoyl)spiro[1H-indole-3,5'-bicyclo[2.2.1]hept-2-ene]-2-one (PubChem CID 4974515) has the molecular formula C21H15ClFNO2 and a molecular weight of 367.81 g/mol. Its IUPAC name is 5-chloro-6'-(4-fluorobenzoyl)spiro[1H-indole-3,5'-bicyclo[2.2.1]hept-2-ene]-2-one.
| Compound Name | 5-chloro-6'-(4-fluorobenzoyl)spiro[1H-indole-3,5'-bicyclo[2.2.1]hept-2-ene]-2-one |
|---|---|
| PubChem CID | 4974515 |
| Molecular Formula | C21H15ClFNO2 |
| Molecular Weight | 367.81 g/mol |
| Exact Mass | 367.08 |
| IUPAC Name | 5-chloro-6'-(4-fluorobenzoyl)spiro[1H-indole-3,5'-bicyclo[2.2.1]hept-2-ene]-2-one |
| SMILES | O=C(c1ccc(F)cc1)C1C2C=CC(C2)C12C(=O)Nc1ccc(Cl)cc12 |
| InChI | InChI=1S/C21H15ClFNO2/c22-14-5-8-17-16(10-14)21(20(26)24-17)13-4-1-12(9-13)18(21)19(25)11-2-6-15(23)7-3-11/h1-8,10,12-13,18H,9H2,(H,24,26) |
| InChIKey | BFWRYHYWKZWXGI-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.81 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|