About CID 95371339
CID 95371339 (PubChem CID 95371339) has the molecular formula C28H21BrClN3O3
and a molecular weight of 562.85 g/mol.
Molecular Properties
| Compound Name | CID 95371339 |
| PubChem CID | 95371339 |
| Molecular Formula | C28H21BrClN3O3 |
| Molecular Weight | 562.85 g/mol |
| Exact Mass | 561.05 |
| IUPAC Name | — |
| SMILES | O=C(c1ccc(Br)cc1)[C@@H]1[C@@]2(C(=O)Nc3ccccc32)[C@@H]2CCCN2[C@@]12C(=O)Nc1ccc(Cl)cc12 |
| InChI | InChI=1S/C28H21BrClN3O3/c29-16-9-7-15(8-10-16)23(34)24-27(18-4-1-2-5-20(18)31-25(27)35)22-6-3-13-33(22)28(24)19-14-17(30)11-12-21(19)32-26(28)36/h1-2,4-5,7-12,14,22,24H,3,6,13H2,(H,31,35)(H,32,36)/t22-,24+,27-,28+/m0/s1 |
| InChIKey | PNDSHIATOJKPKN-ZNSCEPEASA-N |
| XLogP | 5.12 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 562.85 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze CID 95371339 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 95371339?
The IUPAC name of CID 95371339 (CID 95371339) is not available.
What is the SMILES notation for CID 95371339?
The canonical SMILES for CID 95371339 is O=C(c1ccc(Br)cc1)[C@@H]1[C@@]2(C(=O)Nc3ccccc32)[C@@H]2CCCN2[C@@]12C(=O)Nc1ccc(Cl)cc12.
What is the InChIKey of CID 95371339?
The InChIKey is PNDSHIATOJKPKN-ZNSCEPEASA-N. The full InChI is InChI=1S/C28H21BrClN3O3/c29-16-9-7-15(8-10-16)23(34)24-27(18-4-1-2-5-20(18)31-25(27)35)22-6-3-13-33(22)28(24)19-14-17(30)11-12-21(19)32-26(28)36/h1-2,4-5,7-12,14,22,24H,3,6,13H2,(H,31,35)(H,32,36)/t22-,24+,27-,28+/m0/s1.
What are the key properties of CID 95371339?
CID 95371339 has a molecular weight of 562.85 g/mol, XLogP of 5.12, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 95371339 is sourced from PubChem (CID 95371339), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).