C29H23ClN4O5 — CID 98451447
CID 98451447 (PubChem CID 98451447) has the molecular formula C29H23ClN4O5 and a molecular weight of 542.98 g/mol.
| Compound Name | CID 98451447 |
|---|---|
| PubChem CID | 98451447 |
| Molecular Formula | C29H23ClN4O5 |
| Molecular Weight | 542.98 g/mol |
| Exact Mass | 542.14 |
| IUPAC Name | — |
| SMILES | Cc1c(Cl)ccc2c1NC(=O)[C@]21[C@H](C(=O)c2cccc([N+](=O)[O-])c2)[C@]2(C(=O)Nc3ccccc32)[C@H]2CCCN21 |
| InChI | InChI=1S/C29H23ClN4O5/c1-15-20(30)12-11-19-23(15)32-27(37)29(19)25(24(35)16-6-4-7-17(14-16)34(38)39)28(22-10-5-13-33(22)29)18-8-2-3-9-21(18)31-26(28)36/h2-4,6-9,11-12,14,22,25H,5,10,13H2,1H3,(H,31,36)(H,32,37)/t22-,25-,28-,29-/m1/s1 |
| InChIKey | HDQFFEWVVXIMCS-WVVZPGRZSA-N |
| XLogP | 4.57 |
| TPSA | 121.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.98 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|