C30H27N3O5 — CID 163066440
CID 163066440 (PubChem CID 163066440) has the molecular formula C30H27N3O5 and a molecular weight of 509.56 g/mol.
| Compound Name | CID 163066440 |
|---|---|
| PubChem CID | 163066440 |
| Molecular Formula | C30H27N3O5 |
| Molecular Weight | 509.56 g/mol |
| Exact Mass | 509.20 |
| IUPAC Name | — |
| SMILES | COc1ccc(C(=O)[C@@H]2[C@@]3(C(=O)Nc4ccccc43)[C@H]3CCCN3[C@]23C(=O)Nc2ccccc23)cc1OC |
| InChI | InChI=1S/C30H27N3O5/c1-37-22-14-13-17(16-23(22)38-2)25(34)26-29(18-8-3-5-10-20(18)31-27(29)35)24-12-7-15-33(24)30(26)19-9-4-6-11-21(19)32-28(30)36/h3-6,8-11,13-14,16,24,26H,7,12,15H2,1-2H3,(H,31,35)(H,32,36)/t24-,26-,29+,30+/m1/s1 |
| InChIKey | GKYVNSKNUJRCQJ-PGKHYZQDSA-N |
| XLogP | 3.72 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.56 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |