C29H23ClFN3O3 — CID 4890676
CID 4890676 (PubChem CID 4890676) has the molecular formula C29H23ClFN3O3 and a molecular weight of 515.97 g/mol.
| Compound Name | CID 4890676 |
|---|---|
| PubChem CID | 4890676 |
| Molecular Formula | C29H23ClFN3O3 |
| Molecular Weight | 515.97 g/mol |
| Exact Mass | 515.14 |
| IUPAC Name | — |
| SMILES | Cc1cc(Cl)c2c(c1)C1(C(=O)N2)C(C(=O)c2ccc(F)cc2)C2(C(=O)Nc3ccccc32)C2CCCN21 |
| InChI | InChI=1S/C29H23ClFN3O3/c1-15-13-19-23(20(30)14-15)33-27(37)29(19)25(24(35)16-8-10-17(31)11-9-16)28(22-7-4-12-34(22)29)18-5-2-3-6-21(18)32-26(28)36/h2-3,5-6,8-11,13-14,22,25H,4,7,12H2,1H3,(H,32,36)(H,33,37) |
| InChIKey | NMHQKIDTOFABHM-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.97 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |