C30H27N3O3 — CID 162861572
CID 162861572 (PubChem CID 162861572) has the molecular formula C30H27N3O3 and a molecular weight of 477.56 g/mol.
| Compound Name | CID 162861572 |
|---|---|
| PubChem CID | 162861572 |
| Molecular Formula | C30H27N3O3 |
| Molecular Weight | 477.56 g/mol |
| Exact Mass | 477.21 |
| IUPAC Name | — |
| SMILES | Cc1ccc2c(c1C)NC(=O)[C@@]21[C@@H](C(=O)c2ccccc2)[C@@]2(C(=O)Nc3ccccc32)[C@H]2CCCN21 |
| InChI | InChI=1S/C30H27N3O3/c1-17-14-15-21-24(18(17)2)32-28(36)30(21)26(25(34)19-9-4-3-5-10-19)29(23-13-8-16-33(23)30)20-11-6-7-12-22(20)31-27(29)35/h3-7,9-12,14-15,23,26H,8,13,16H2,1-2H3,(H,31,35)(H,32,36)/t23-,26+,29+,30+/m1/s1 |
| InChIKey | OEMOBXILVBMUHM-KGHIKEGSSA-N |
| XLogP | 4.32 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.56 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |