About CID 6356527
CID 6356527 (PubChem CID 6356527) has the molecular formula C30H26N4O5
and a molecular weight of 522.56 g/mol.
Molecular Properties
| Compound Name | CID 6356527 |
| PubChem CID | 6356527 |
| Molecular Formula | C30H26N4O5 |
| Molecular Weight | 522.56 g/mol |
| Exact Mass | 522.19 |
| IUPAC Name | — |
| SMILES | Cc1ccc2c(c1C)NC(=O)[C@@]21[C@H](C(=O)c2cccc([N+](=O)[O-])c2)[C@@]2(C(=O)Nc3ccccc32)[C@H]2CCCN21 |
| InChI | InChI=1S/C30H26N4O5/c1-16-12-13-21-24(17(16)2)32-28(37)30(21)26(25(35)18-7-5-8-19(15-18)34(38)39)29(23-11-6-14-33(23)30)20-9-3-4-10-22(20)31-27(29)36/h3-5,7-10,12-13,15,23,26H,6,11,14H2,1-2H3,(H,31,36)(H,32,37)/t23-,26-,29+,30+/m1/s1 |
| InChIKey | NGFOLCMPKJGNRL-CDBRBCFXSA-N |
| XLogP | 4.23 |
| TPSA | 121.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 522.56 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 6356527 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 6356527?
The IUPAC name of CID 6356527 (CID 6356527) is not available.
What is the SMILES notation for CID 6356527?
The canonical SMILES for CID 6356527 is Cc1ccc2c(c1C)NC(=O)[C@@]21[C@H](C(=O)c2cccc([N+](=O)[O-])c2)[C@@]2(C(=O)Nc3ccccc32)[C@H]2CCCN21.
What is the InChIKey of CID 6356527?
The InChIKey is NGFOLCMPKJGNRL-CDBRBCFXSA-N. The full InChI is InChI=1S/C30H26N4O5/c1-16-12-13-21-24(17(16)2)32-28(37)30(21)26(25(35)18-7-5-8-19(15-18)34(38)39)29(23-11-6-14-33(23)30)20-9-3-4-10-22(20)31-27(29)36/h3-5,7-10,12-13,15,23,26H,6,11,14H2,1-2H3,(H,31,36)(H,32,37)/t23-,26-,29+,30+/m1/s1.
What are the key properties of CID 6356527?
CID 6356527 has a molecular weight of 522.56 g/mol, XLogP of 4.23, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 6356527 is sourced from PubChem (CID 6356527), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).