C30H26N4O5 — CID 6356527
CID 6356527 (PubChem CID 6356527) has the molecular formula C30H26N4O5 and a molecular weight of 522.56 g/mol.
| Compound Name | CID 6356527 |
|---|---|
| PubChem CID | 6356527 |
| Molecular Formula | C30H26N4O5 |
| Molecular Weight | 522.56 g/mol |
| Exact Mass | 522.19 |
| IUPAC Name | — |
| SMILES | Cc1ccc2c(c1C)NC(=O)[C@@]21[C@H](C(=O)c2cccc([N+](=O)[O-])c2)[C@@]2(C(=O)Nc3ccccc32)[C@H]2CCCN21 |
| InChI | InChI=1S/C30H26N4O5/c1-16-12-13-21-24(17(16)2)32-28(37)30(21)26(25(35)18-7-5-8-19(15-18)34(38)39)29(23-11-6-14-33(23)30)20-9-3-4-10-22(20)31-27(29)36/h3-5,7-10,12-13,15,23,26H,6,11,14H2,1-2H3,(H,31,36)(H,32,37)/t23-,26-,29+,30+/m1/s1 |
| InChIKey | NGFOLCMPKJGNRL-CDBRBCFXSA-N |
| XLogP | 4.23 |
| TPSA | 121.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.56 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|