C28H24N4O5 — CID 163173362
CID 163173362 (PubChem CID 163173362) has the molecular formula C28H24N4O5 and a molecular weight of 496.52 g/mol.
| Compound Name | CID 163173362 |
|---|---|
| PubChem CID | 163173362 |
| Molecular Formula | C28H24N4O5 |
| Molecular Weight | 496.52 g/mol |
| Exact Mass | 496.17 |
| IUPAC Name | — |
| SMILES | O=C(c1cccc([NH+]([O-])O)c1)C1C2(C(=O)Nc3ccccc32)C2CCCN2C12C(=O)Nc1ccccc12 |
| InChI | InChI=1S/C28H24N4O5/c33-23(16-7-5-8-17(15-16)32(36)37)24-27(18-9-1-3-11-20(18)29-25(27)34)22-13-6-14-31(22)28(24)19-10-2-4-12-21(19)30-26(28)35/h1-5,7-12,15,22,24,32,36H,6,13-14H2,(H,29,34)(H,30,35) |
| InChIKey | WHBFGSOIHIRWSH-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 126.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.52 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|