C23H32N2O4 — CID 4975043
2-(4,7-dimethyl-2-oxochromen-5-yl)oxy-N-(2,2,6,6-tetramethylpiperidin-4-yl)propanamide (PubChem CID 4975043) has the molecular formula C23H32N2O4 and a molecular weight of 400.52 g/mol. Its IUPAC name is 2-(4,7-dimethyl-2-oxochromen-5-yl)oxy-N-(2,2,6,6-tetramethylpiperidin-4-yl)propanamide.
| Compound Name | 2-(4,7-dimethyl-2-oxochromen-5-yl)oxy-N-(2,2,6,6-tetramethylpiperidin-4-yl)propanamide |
|---|---|
| PubChem CID | 4975043 |
| Molecular Formula | C23H32N2O4 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.24 |
| IUPAC Name | 2-(4,7-dimethyl-2-oxochromen-5-yl)oxy-N-(2,2,6,6-tetramethylpiperidin-4-yl)propanamide |
| SMILES | Cc1cc(OC(C)C(=O)NC2CC(C)(C)NC(C)(C)C2)c2c(C)cc(=O)oc2c1 |
| InChI | InChI=1S/C23H32N2O4/c1-13-8-17(20-14(2)10-19(26)29-18(20)9-13)28-15(3)21(27)24-16-11-22(4,5)25-23(6,7)12-16/h8-10,15-16,25H,11-12H2,1-7H3,(H,24,27) |
| InChIKey | ACKDWBVCSKCWSD-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|