C15H16O5 — CID 969730
methyl (2R)-2-(4,7-dimethyl-2-oxochromen-5-yl)oxypropanoate (PubChem CID 969730) has the molecular formula C15H16O5 and a molecular weight of 276.29 g/mol. Its IUPAC name is methyl (2R)-2-(4,7-dimethyl-2-oxochromen-5-yl)oxypropanoate.
| Compound Name | methyl (2R)-2-(4,7-dimethyl-2-oxochromen-5-yl)oxypropanoate |
|---|---|
| PubChem CID | 969730 |
| Molecular Formula | C15H16O5 |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | methyl (2R)-2-(4,7-dimethyl-2-oxochromen-5-yl)oxypropanoate |
| SMILES | COC(=O)[C@@H](C)Oc1cc(C)cc2oc(=O)cc(C)c12 |
| InChI | InChI=1S/C15H16O5/c1-8-5-11(19-10(3)15(17)18-4)14-9(2)7-13(16)20-12(14)6-8/h5-7,10H,1-4H3/t10-/m1/s1 |
| InChIKey | ZFSPWDOWSHDSPZ-SNVBAGLBSA-N |
| XLogP | 2.35 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|