C11H9N3O2S2 — CID 4976358
2-imino-3-(6-methoxy-1,3-benzothiazol-2-yl)-1,3-thiazolidin-4-one (PubChem CID 4976358) has the molecular formula C11H9N3O2S2 and a molecular weight of 279.35 g/mol. Its IUPAC name is 2-imino-3-(6-methoxy-1,3-benzothiazol-2-yl)-1,3-thiazolidin-4-one.
| Compound Name | 2-imino-3-(6-methoxy-1,3-benzothiazol-2-yl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 4976358 |
| Molecular Formula | C11H9N3O2S2 |
| Molecular Weight | 279.35 g/mol |
| Exact Mass | 279.01 |
| IUPAC Name | 2-imino-3-(6-methoxy-1,3-benzothiazol-2-yl)-1,3-thiazolidin-4-one |
| SMILES | [H]/N=C1\SCC(=O)N1c1nc2ccc(OC)cc2s1 |
| InChI | InChI=1S/C11H9N3O2S2/c1-16-6-2-3-7-8(4-6)18-11(13-7)14-9(15)5-17-10(14)12/h2-4,12H,5H2,1H3/b12-10- |
| InChIKey | RSHZIQUYTOAELG-BENRWUELSA-N |
| XLogP | 2.32 |
| TPSA | 66.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.35 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|