C31H34Cl2N4O4 — CID 4978442
N-[[3,6-dichloro-2,7-bis(2-morpholin-4-ylethoxy)fluoren-9-ylidene]amino]aniline (PubChem CID 4978442) has the molecular formula C31H34Cl2N4O4 and a molecular weight of 597.54 g/mol. Its IUPAC name is N-[[3,6-dichloro-2,7-bis(2-morpholin-4-ylethoxy)fluoren-9-ylidene]amino]aniline.
| Compound Name | N-[[3,6-dichloro-2,7-bis(2-morpholin-4-ylethoxy)fluoren-9-ylidene]amino]aniline |
|---|---|
| PubChem CID | 4978442 |
| Molecular Formula | C31H34Cl2N4O4 |
| Molecular Weight | 597.54 g/mol |
| Exact Mass | 596.20 |
| IUPAC Name | N-[[3,6-dichloro-2,7-bis(2-morpholin-4-ylethoxy)fluoren-9-ylidene]amino]aniline |
| SMILES | Clc1cc2c(cc1OCCN1CCOCC1)C(=NNc1ccccc1)c1cc(OCCN3CCOCC3)c(Cl)cc1-2 |
| InChI | InChI=1S/C31H34Cl2N4O4/c32-27-18-23-24-19-28(33)30(41-17-11-37-8-14-39-15-9-37)21-26(24)31(35-34-22-4-2-1-3-5-22)25(23)20-29(27)40-16-10-36-6-12-38-13-7-36/h1-5,18-21,34H,6-17H2 |
| InChIKey | RERLHHRWYOEJNY-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.54 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|