C26H47N2O3+ — CID 4979049
3-[(8a-methyl-2-oxospiro[3a,4,4a,6,7,8,9,9a-octahydro-3H-benzo[f][1]benzofuran-5,2'-oxirane]-3-yl)methylamino]propyl-dibutylazanium (PubChem CID 4979049) has the molecular formula C26H47N2O3+ and a molecular weight of 435.67 g/mol. Its IUPAC name is 3-[(8a-methyl-2-oxospiro[3a,4,4a,6,7,8,9,9a-octahydro-3H-benzo[f][1]benzofuran-5,2'-oxirane]-3-yl)methylamino]propyl-dibutylazanium.
| Compound Name | 3-[(8a-methyl-2-oxospiro[3a,4,4a,6,7,8,9,9a-octahydro-3H-benzo[f][1]benzofuran-5,2'-oxirane]-3-yl)methylamino]propyl-dibutylazanium |
|---|---|
| PubChem CID | 4979049 |
| Molecular Formula | C26H47N2O3+ |
| Molecular Weight | 435.67 g/mol |
| Exact Mass | 435.36 |
| IUPAC Name | 3-[(8a-methyl-2-oxospiro[3a,4,4a,6,7,8,9,9a-octahydro-3H-benzo[f][1]benzofuran-5,2'-oxirane]-3-yl)methylamino]propyl-dibutylazanium |
| SMILES | CCCC[NH+](CCCC)CCCNCC1C(=O)OC2CC3(C)CCCC4(CO4)C3CC21 |
| InChI | InChI=1S/C26H46N2O3/c1-4-6-13-28(14-7-5-2)15-9-12-27-18-21-20-16-23-25(3,17-22(20)31-24(21)29)10-8-11-26(23)19-30-26/h20-23,27H,4-19H2,1-3H3/p+1 |
| InChIKey | XACOJSKEQRDALU-UHFFFAOYSA-O |
| XLogP | 2.98 |
| TPSA | 55.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.67 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|