C48H48N2O12 — CID 4979246
[6-methoxy-2-phenyl-7-[3-phenyl-2-(phenylmethoxycarbonylamino)propanoyl]oxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] 3-phenyl-2-(phenylmethoxycarbonylamino)propanoate (PubChem CID 4979246) has the molecular formula C48H48N2O12 and a molecular weight of 844.91 g/mol. Its IUPAC name is [6-methoxy-2-phenyl-7-[3-phenyl-2-(phenylmethoxycarbonylamino)propanoyl]oxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] 3-phenyl-2-(phenylmethoxycarbonylamino)propanoate.
| Compound Name | [6-methoxy-2-phenyl-7-[3-phenyl-2-(phenylmethoxycarbonylamino)propanoyl]oxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] 3-phenyl-2-(phenylmethoxycarbonylamino)propanoate |
|---|---|
| PubChem CID | 4979246 |
| Molecular Formula | C48H48N2O12 |
| Molecular Weight | 844.91 g/mol |
| Exact Mass | 844.32 |
| IUPAC Name | [6-methoxy-2-phenyl-7-[3-phenyl-2-(phenylmethoxycarbonylamino)propanoyl]oxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] 3-phenyl-2-(phenylmethoxycarbonylamino)propanoate |
| SMILES | COC1OC2COC(c3ccccc3)OC2C(OC(=O)C(Cc2ccccc2)NC(=O)OCc2ccccc2)C1OC(=O)C(Cc1ccccc1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C48H48N2O12/c1-55-46-42(61-44(52)38(28-33-19-9-3-10-20-33)50-48(54)58-30-35-23-13-5-14-24-35)41(40-39(59-46)31-56-45(62-40)36-25-15-6-16-26-36)60-43(51)37(27-32-17-7-2-8-18-32)49-47(53)57-29-34-21-11-4-12-22-34/h2-26,37-42,45-46H,27-31H2,1H3,(H,49,53)(H,50,54) |
| InChIKey | SJMVDKDXLWEBAX-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 166.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 62 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 844.91 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|