C21H44NO4P — CID 4983342
2-dihexoxyphosphoryl-N,N-dipropylpropanamide (PubChem CID 4983342) has the molecular formula C21H44NO4P and a molecular weight of 405.56 g/mol. Its IUPAC name is 2-dihexoxyphosphoryl-N,N-dipropylpropanamide.
| Compound Name | 2-dihexoxyphosphoryl-N,N-dipropylpropanamide |
|---|---|
| PubChem CID | 4983342 |
| Molecular Formula | C21H44NO4P |
| Molecular Weight | 405.56 g/mol |
| Exact Mass | 405.30 |
| IUPAC Name | 2-dihexoxyphosphoryl-N,N-dipropylpropanamide |
| SMILES | CCCCCCOP(=O)(OCCCCCC)C(C)C(=O)N(CCC)CCC |
| InChI | InChI=1S/C21H44NO4P/c1-6-10-12-14-18-25-27(24,26-19-15-13-11-7-2)20(5)21(23)22(16-8-3)17-9-4/h20H,6-19H2,1-5H3 |
| InChIKey | SNHHKETXYDYLNN-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.56 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|