C16H13N3O4 — CID 4986523
2-hydroxyimino-6-methoxy-N-pyridin-2-ylchromene-3-carboxamide (PubChem CID 4986523) has the molecular formula C16H13N3O4 and a molecular weight of 311.30 g/mol. Its IUPAC name is 2-hydroxyimino-6-methoxy-N-pyridin-2-ylchromene-3-carboxamide.
| Compound Name | 2-hydroxyimino-6-methoxy-N-pyridin-2-ylchromene-3-carboxamide |
|---|---|
| PubChem CID | 4986523 |
| Molecular Formula | C16H13N3O4 |
| Molecular Weight | 311.30 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | 2-hydroxyimino-6-methoxy-N-pyridin-2-ylchromene-3-carboxamide |
| SMILES | COc1ccc2oc(=NO)c(C(=O)Nc3ccccn3)cc2c1 |
| InChI | InChI=1S/C16H13N3O4/c1-22-11-5-6-13-10(8-11)9-12(16(19-21)23-13)15(20)18-14-4-2-3-7-17-14/h2-9,21H,1H3,(H,17,18,20) |
| InChIKey | HMBUMOXLDNTTDM-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 96.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.30 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|