C28H29N5O2 — CID 4987473
N-[3-[3-[[4-(N-prop-2-enylanilino)quinazolin-2-yl]amino]propoxy]phenyl]acetamide (PubChem CID 4987473) has the molecular formula C28H29N5O2 and a molecular weight of 467.57 g/mol. Its IUPAC name is N-[3-[3-[[4-(N-prop-2-enylanilino)quinazolin-2-yl]amino]propoxy]phenyl]acetamide.
| Compound Name | N-[3-[3-[[4-(N-prop-2-enylanilino)quinazolin-2-yl]amino]propoxy]phenyl]acetamide |
|---|---|
| PubChem CID | 4987473 |
| Molecular Formula | C28H29N5O2 |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.23 |
| IUPAC Name | N-[3-[3-[[4-(N-prop-2-enylanilino)quinazolin-2-yl]amino]propoxy]phenyl]acetamide |
| SMILES | C=CCN(c1ccccc1)c1nc(NCCCOc2cccc(NC(C)=O)c2)nc2ccccc12 |
| InChI | InChI=1S/C28H29N5O2/c1-3-18-33(23-12-5-4-6-13-23)27-25-15-7-8-16-26(25)31-28(32-27)29-17-10-19-35-24-14-9-11-22(20-24)30-21(2)34/h3-9,11-16,20H,1,10,17-19H2,2H3,(H,30,34)(H,29,31,32) |
| InChIKey | FKANDMBGBYMITG-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|