C23H21Cl2N3O6S — CID 4989324
2-(3,4-dichloro-N-(2-methoxy-5-methylphenyl)sulfonylanilino)-N-(2-methyl-3-nitrophenyl)acetamide (PubChem CID 4989324) has the molecular formula C23H21Cl2N3O6S and a molecular weight of 538.41 g/mol. Its IUPAC name is 2-(3,4-dichloro-N-(2-methoxy-5-methylphenyl)sulfonylanilino)-N-(2-methyl-3-nitrophenyl)acetamide.
| Compound Name | 2-(3,4-dichloro-N-(2-methoxy-5-methylphenyl)sulfonylanilino)-N-(2-methyl-3-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 4989324 |
| Molecular Formula | C23H21Cl2N3O6S |
| Molecular Weight | 538.41 g/mol |
| Exact Mass | 537.05 |
| IUPAC Name | 2-(3,4-dichloro-N-(2-methoxy-5-methylphenyl)sulfonylanilino)-N-(2-methyl-3-nitrophenyl)acetamide |
| SMILES | COc1ccc(C)cc1S(=O)(=O)N(CC(=O)Nc1cccc([N+](=O)[O-])c1C)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C23H21Cl2N3O6S/c1-14-7-10-21(34-3)22(11-14)35(32,33)27(16-8-9-17(24)18(25)12-16)13-23(29)26-19-5-4-6-20(15(19)2)28(30)31/h4-12H,13H2,1-3H3,(H,26,29) |
| InChIKey | COVOLFYCDYPVSC-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.41 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|