C17H18F3NO4S2 — CID 4994942
methyl 5-tert-butyl-3-[[3-(trifluoromethyl)phenyl]sulfonylamino]thiophene-2-carboxylate (PubChem CID 4994942) has the molecular formula C17H18F3NO4S2 and a molecular weight of 421.46 g/mol. Its IUPAC name is methyl 5-tert-butyl-3-[[3-(trifluoromethyl)phenyl]sulfonylamino]thiophene-2-carboxylate.
| Compound Name | methyl 5-tert-butyl-3-[[3-(trifluoromethyl)phenyl]sulfonylamino]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 4994942 |
| Molecular Formula | C17H18F3NO4S2 |
| Molecular Weight | 421.46 g/mol |
| Exact Mass | 421.06 |
| IUPAC Name | methyl 5-tert-butyl-3-[[3-(trifluoromethyl)phenyl]sulfonylamino]thiophene-2-carboxylate |
| SMILES | COC(=O)c1sc(C(C)(C)C)cc1NS(=O)(=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H18F3NO4S2/c1-16(2,3)13-9-12(14(26-13)15(22)25-4)21-27(23,24)11-7-5-6-10(8-11)17(18,19)20/h5-9,21H,1-4H3 |
| InChIKey | ITLJYDMRLRMADE-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.46 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |