C21H28N2O2S2 — CID 4996297
1-(4-tert-butylphenyl)sulfonyl-4-(2-methylsulfanylphenyl)piperazine (PubChem CID 4996297) has the molecular formula C21H28N2O2S2 and a molecular weight of 404.60 g/mol. Its IUPAC name is 1-(4-tert-butylphenyl)sulfonyl-4-(2-methylsulfanylphenyl)piperazine.
| Compound Name | 1-(4-tert-butylphenyl)sulfonyl-4-(2-methylsulfanylphenyl)piperazine |
|---|---|
| PubChem CID | 4996297 |
| Molecular Formula | C21H28N2O2S2 |
| Molecular Weight | 404.60 g/mol |
| Exact Mass | 404.16 |
| IUPAC Name | 1-(4-tert-butylphenyl)sulfonyl-4-(2-methylsulfanylphenyl)piperazine |
| SMILES | CSc1ccccc1N1CCN(S(=O)(=O)c2ccc(C(C)(C)C)cc2)CC1 |
| InChI | InChI=1S/C21H28N2O2S2/c1-21(2,3)17-9-11-18(12-10-17)27(24,25)23-15-13-22(14-16-23)19-7-5-6-8-20(19)26-4/h5-12H,13-16H2,1-4H3 |
| InChIKey | BGGHOTHFEPDHJX-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.60 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |