C24H21ClN6O4S — CID 4997997
2-[1-[2-(2-chlorophenyl)acetyl]piperidin-4-yl]-N-(5-nitro-1H-indazol-3-yl)-1,3-thiazole-4-carboxamide (PubChem CID 4997997) has the molecular formula C24H21ClN6O4S and a molecular weight of 524.99 g/mol. Its IUPAC name is 2-[1-[2-(2-chlorophenyl)acetyl]piperidin-4-yl]-N-(5-nitro-1H-indazol-3-yl)-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[1-[2-(2-chlorophenyl)acetyl]piperidin-4-yl]-N-(5-nitro-1H-indazol-3-yl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 4997997 |
| Molecular Formula | C24H21ClN6O4S |
| Molecular Weight | 524.99 g/mol |
| Exact Mass | 524.10 |
| IUPAC Name | 2-[1-[2-(2-chlorophenyl)acetyl]piperidin-4-yl]-N-(5-nitro-1H-indazol-3-yl)-1,3-thiazole-4-carboxamide |
| SMILES | O=C(Nc1n[nH]c2ccc([N+](=O)[O-])cc12)c1csc(C2CCN(C(=O)Cc3ccccc3Cl)CC2)n1 |
| InChI | InChI=1S/C24H21ClN6O4S/c25-18-4-2-1-3-15(18)11-21(32)30-9-7-14(8-10-30)24-26-20(13-36-24)23(33)27-22-17-12-16(31(34)35)5-6-19(17)28-29-22/h1-6,12-14H,7-11H2,(H2,27,28,29,33) |
| InChIKey | WKSHWRKCYKGDDJ-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 134.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.99 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|