C20H23N3O4 — CID 4998070
[[2-[2-(2-methoxy-4-prop-2-enylphenoxy)ethoxy]phenyl]methylideneamino]urea (PubChem CID 4998070) has the molecular formula C20H23N3O4 and a molecular weight of 369.42 g/mol. Its IUPAC name is [[2-[2-(2-methoxy-4-prop-2-enylphenoxy)ethoxy]phenyl]methylideneamino]urea.
| Compound Name | [[2-[2-(2-methoxy-4-prop-2-enylphenoxy)ethoxy]phenyl]methylideneamino]urea |
|---|---|
| PubChem CID | 4998070 |
| Molecular Formula | C20H23N3O4 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | [[2-[2-(2-methoxy-4-prop-2-enylphenoxy)ethoxy]phenyl]methylideneamino]urea |
| SMILES | C=CCc1ccc(OCCOc2ccccc2C=NNC(N)=O)c(OC)c1 |
| InChI | InChI=1S/C20H23N3O4/c1-3-6-15-9-10-18(19(13-15)25-2)27-12-11-26-17-8-5-4-7-16(17)14-22-23-20(21)24/h3-5,7-10,13-14H,1,6,11-12H2,2H3,(H3,21,23,24) |
| InChIKey | KELDOXSCHDMIMG-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 95.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|