C13H12Cl2N2O2 — CID 5004523
3-(2,3-dichlorophenyl)-1-(furan-2-ylmethyl)-1-methylurea (PubChem CID 5004523) has the molecular formula C13H12Cl2N2O2 and a molecular weight of 299.16 g/mol. Its IUPAC name is 3-(2,3-dichlorophenyl)-1-(furan-2-ylmethyl)-1-methylurea.
| Compound Name | 3-(2,3-dichlorophenyl)-1-(furan-2-ylmethyl)-1-methylurea |
|---|---|
| PubChem CID | 5004523 |
| Molecular Formula | C13H12Cl2N2O2 |
| Molecular Weight | 299.16 g/mol |
| Exact Mass | 298.03 |
| IUPAC Name | 3-(2,3-dichlorophenyl)-1-(furan-2-ylmethyl)-1-methylurea |
| SMILES | CN(Cc1ccco1)C(=O)Nc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C13H12Cl2N2O2/c1-17(8-9-4-3-7-19-9)13(18)16-11-6-2-5-10(14)12(11)15/h2-7H,8H2,1H3,(H,16,18) |
| InChIKey | HEEYHLNVZGBSMK-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.16 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |