C17H18Cl2N2O3 — CID 7318862
(3R)-N-(2,3-dichlorophenyl)-N'-(furan-2-ylmethyl)-3-methylpentanediamide (PubChem CID 7318862) has the molecular formula C17H18Cl2N2O3 and a molecular weight of 369.25 g/mol. Its IUPAC name is (3R)-N-(2,3-dichlorophenyl)-N'-(furan-2-ylmethyl)-3-methylpentanediamide.
| Compound Name | (3R)-N-(2,3-dichlorophenyl)-N'-(furan-2-ylmethyl)-3-methylpentanediamide |
|---|---|
| PubChem CID | 7318862 |
| Molecular Formula | C17H18Cl2N2O3 |
| Molecular Weight | 369.25 g/mol |
| Exact Mass | 368.07 |
| IUPAC Name | (3R)-N-(2,3-dichlorophenyl)-N'-(furan-2-ylmethyl)-3-methylpentanediamide |
| SMILES | C[C@H](CC(=O)NCc1ccco1)CC(=O)Nc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C17H18Cl2N2O3/c1-11(8-15(22)20-10-12-4-3-7-24-12)9-16(23)21-14-6-2-5-13(18)17(14)19/h2-7,11H,8-10H2,1H3,(H,20,22)(H,21,23)/t11-/m1/s1 |
| InChIKey | JLPHZEBZXGYGFK-LLVKDONJSA-N |
| XLogP | 4.26 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.25 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |