C16H11FN2O3S3 — CID 501551
N-[5-[(2-fluorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzenesulfonamide (PubChem CID 501551) has the molecular formula C16H11FN2O3S3 and a molecular weight of 394.47 g/mol. Its IUPAC name is N-[5-[(2-fluorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzenesulfonamide.
| Compound Name | N-[5-[(2-fluorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 501551 |
| Molecular Formula | C16H11FN2O3S3 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 393.99 |
| IUPAC Name | N-[5-[(2-fluorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzenesulfonamide |
| SMILES | O=C1C(=Cc2ccccc2F)SC(=S)N1NS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C16H11FN2O3S3/c17-13-9-5-4-6-11(13)10-14-15(20)19(16(23)24-14)18-25(21,22)12-7-2-1-3-8-12/h1-10,18H |
| InChIKey | KLJROENVNSBZTR-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|