C16H9F3N2O3S3 — CID 6478105
N-[(5E)-4-oxo-2-sulfanylidene-5-[(2,3,4-trifluorophenyl)methylidene]-1,3-thiazolidin-3-yl]benzenesulfonamide (PubChem CID 6478105) has the molecular formula C16H9F3N2O3S3 and a molecular weight of 430.45 g/mol. Its IUPAC name is N-[(5E)-4-oxo-2-sulfanylidene-5-[(2,3,4-trifluorophenyl)methylidene]-1,3-thiazolidin-3-yl]benzenesulfonamide.
| Compound Name | N-[(5E)-4-oxo-2-sulfanylidene-5-[(2,3,4-trifluorophenyl)methylidene]-1,3-thiazolidin-3-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 6478105 |
| Molecular Formula | C16H9F3N2O3S3 |
| Molecular Weight | 430.45 g/mol |
| Exact Mass | 429.97 |
| IUPAC Name | N-[(5E)-4-oxo-2-sulfanylidene-5-[(2,3,4-trifluorophenyl)methylidene]-1,3-thiazolidin-3-yl]benzenesulfonamide |
| SMILES | O=C1/C(=C\c2ccc(F)c(F)c2F)SC(=S)N1NS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C16H9F3N2O3S3/c17-11-7-6-9(13(18)14(11)19)8-12-15(22)21(16(25)26-12)20-27(23,24)10-4-2-1-3-5-10/h1-8,20H/b12-8+ |
| InChIKey | JAVWTLRJAKGQNZ-XYOKQWHBSA-N |
| XLogP | 3.20 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.45 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|