C18H14N2O5S3 — CID 6478098
N-[(5E)-5-(2,3-dihydro-1,4-benzodioxin-6-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzenesulfonamide (PubChem CID 6478098) has the molecular formula C18H14N2O5S3 and a molecular weight of 434.52 g/mol. Its IUPAC name is N-[(5E)-5-(2,3-dihydro-1,4-benzodioxin-6-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzenesulfonamide.
| Compound Name | N-[(5E)-5-(2,3-dihydro-1,4-benzodioxin-6-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 6478098 |
| Molecular Formula | C18H14N2O5S3 |
| Molecular Weight | 434.52 g/mol |
| Exact Mass | 434.01 |
| IUPAC Name | N-[(5E)-5-(2,3-dihydro-1,4-benzodioxin-6-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzenesulfonamide |
| SMILES | O=C1/C(=C\c2ccc3c(c2)OCCO3)SC(=S)N1NS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C18H14N2O5S3/c21-17-16(11-12-6-7-14-15(10-12)25-9-8-24-14)27-18(26)20(17)19-28(22,23)13-4-2-1-3-5-13/h1-7,10-11,19H,8-9H2/b16-11+ |
| InChIKey | MRZRTMRTPVTCPI-LFIBNONCSA-N |
| XLogP | 2.55 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.52 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|