C27H29N3O2 — CID 5016926
6-[4-(diethylamino)phenyl]-9-(furan-2-yl)-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one (PubChem CID 5016926) has the molecular formula C27H29N3O2 and a molecular weight of 427.55 g/mol. Its IUPAC name is 6-[4-(diethylamino)phenyl]-9-(furan-2-yl)-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one.
| Compound Name | 6-[4-(diethylamino)phenyl]-9-(furan-2-yl)-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one |
|---|---|
| PubChem CID | 5016926 |
| Molecular Formula | C27H29N3O2 |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.23 |
| IUPAC Name | 6-[4-(diethylamino)phenyl]-9-(furan-2-yl)-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one |
| SMILES | CCN(CC)c1ccc(C2Nc3ccccc3NC3=C2C(=O)CC(c2ccco2)C3)cc1 |
| InChI | InChI=1S/C27H29N3O2/c1-3-30(4-2)20-13-11-18(12-14-20)27-26-23(28-21-8-5-6-9-22(21)29-27)16-19(17-24(26)31)25-10-7-15-32-25/h5-15,19,27-29H,3-4,16-17H2,1-2H3 |
| InChIKey | LOHBBIJNKKFBPB-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 57.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |