C29H26ClN3O2 — CID 5017514
3-[4-[(4-chlorophenyl)methoxy]-3-ethoxy-5-prop-2-enylphenyl]-2-(6-methyl-1H-benzimidazol-2-yl)prop-2-enenitrile (PubChem CID 5017514) has the molecular formula C29H26ClN3O2 and a molecular weight of 484.00 g/mol. Its IUPAC name is 3-[4-[(4-chlorophenyl)methoxy]-3-ethoxy-5-prop-2-enylphenyl]-2-(6-methyl-1H-benzimidazol-2-yl)prop-2-enenitrile.
| Compound Name | 3-[4-[(4-chlorophenyl)methoxy]-3-ethoxy-5-prop-2-enylphenyl]-2-(6-methyl-1H-benzimidazol-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 5017514 |
| Molecular Formula | C29H26ClN3O2 |
| Molecular Weight | 484.00 g/mol |
| Exact Mass | 483.17 |
| IUPAC Name | 3-[4-[(4-chlorophenyl)methoxy]-3-ethoxy-5-prop-2-enylphenyl]-2-(6-methyl-1H-benzimidazol-2-yl)prop-2-enenitrile |
| SMILES | C=CCc1cc(C=C(C#N)c2nc3ccc(C)cc3[nH]2)cc(OCC)c1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C29H26ClN3O2/c1-4-6-22-14-21(15-23(17-31)29-32-25-12-7-19(3)13-26(25)33-29)16-27(34-5-2)28(22)35-18-20-8-10-24(30)11-9-20/h4,7-16H,1,5-6,18H2,2-3H3,(H,32,33) |
| InChIKey | YIZUOMIZXMRUST-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 70.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.00 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|