C18H14N4S — CID 5018617
6-imino-2-methylsulfanyl-1,4-diphenylpyrimidine-5-carbonitrile (PubChem CID 5018617) has the molecular formula C18H14N4S and a molecular weight of 318.41 g/mol. Its IUPAC name is 6-imino-2-methylsulfanyl-1,4-diphenylpyrimidine-5-carbonitrile.
| Compound Name | 6-imino-2-methylsulfanyl-1,4-diphenylpyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 5018617 |
| Molecular Formula | C18H14N4S |
| Molecular Weight | 318.41 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | 6-imino-2-methylsulfanyl-1,4-diphenylpyrimidine-5-carbonitrile |
| SMILES | [H]/N=c1\c(C#N)c(-c2ccccc2)nc(SC)n1-c1ccccc1 |
| InChI | InChI=1S/C18H14N4S/c1-23-18-21-16(13-8-4-2-5-9-13)15(12-19)17(20)22(18)14-10-6-3-7-11-14/h2-11,20H,1H3/b20-17+ |
| InChIKey | WTXUWRZHJCLILT-LVZFUZTISA-N |
| XLogP | 3.61 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.41 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |