C20H14N4 — CID 793776
6-methyl-4,5-diphenylpyrrolo[3,2-d]pyrimidine-7-carbonitrile (PubChem CID 793776) has the molecular formula C20H14N4 and a molecular weight of 310.36 g/mol. Its IUPAC name is 6-methyl-4,5-diphenylpyrrolo[3,2-d]pyrimidine-7-carbonitrile.
| Compound Name | 6-methyl-4,5-diphenylpyrrolo[3,2-d]pyrimidine-7-carbonitrile |
|---|---|
| PubChem CID | 793776 |
| Molecular Formula | C20H14N4 |
| Molecular Weight | 310.36 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | 6-methyl-4,5-diphenylpyrrolo[3,2-d]pyrimidine-7-carbonitrile |
| SMILES | Cc1c(C#N)c2ncnc(-c3ccccc3)c2n1-c1ccccc1 |
| InChI | InChI=1S/C20H14N4/c1-14-17(12-21)19-20(24(14)16-10-6-3-7-11-16)18(22-13-23-19)15-8-4-2-5-9-15/h2-11,13H,1H3 |
| InChIKey | OABKLXSTDIQNIN-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 54.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.36 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |