C23H16N6 — CID 134093096
3-imino-2,5-diphenyl-6-phenyldiazenylpyridazine-4-carbonitrile (PubChem CID 134093096) has the molecular formula C23H16N6 and a molecular weight of 376.42 g/mol. Its IUPAC name is 3-imino-2,5-diphenyl-6-phenyldiazenylpyridazine-4-carbonitrile.
| Compound Name | 3-imino-2,5-diphenyl-6-phenyldiazenylpyridazine-4-carbonitrile |
|---|---|
| PubChem CID | 134093096 |
| Molecular Formula | C23H16N6 |
| Molecular Weight | 376.42 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | 3-imino-2,5-diphenyl-6-phenyldiazenylpyridazine-4-carbonitrile |
| SMILES | [H]/N=c1\c(C#N)c(-c2ccccc2)c(/N=N/c2ccccc2)nn1-c1ccccc1 |
| InChI | InChI=1S/C23H16N6/c24-16-20-21(17-10-4-1-5-11-17)23(27-26-18-12-6-2-7-13-18)28-29(22(20)25)19-14-8-3-9-15-19/h1-15,25H/b25-22+,27-26+ |
| InChIKey | ZDIAQJOMENZAPO-QCGXGSKBSA-N |
| XLogP | 5.31 |
| TPSA | 90.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.42 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|