C23H29N3O5S — CID 5023891
N-[1-(3,4-dimethoxyphenyl)-3-(3-morpholin-4-ylpropylamino)-3-oxoprop-1-en-2-yl]thiophene-2-carboxamide (PubChem CID 5023891) has the molecular formula C23H29N3O5S and a molecular weight of 459.57 g/mol. Its IUPAC name is N-[1-(3,4-dimethoxyphenyl)-3-(3-morpholin-4-ylpropylamino)-3-oxoprop-1-en-2-yl]thiophene-2-carboxamide.
| Compound Name | N-[1-(3,4-dimethoxyphenyl)-3-(3-morpholin-4-ylpropylamino)-3-oxoprop-1-en-2-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 5023891 |
| Molecular Formula | C23H29N3O5S |
| Molecular Weight | 459.57 g/mol |
| Exact Mass | 459.18 |
| IUPAC Name | N-[1-(3,4-dimethoxyphenyl)-3-(3-morpholin-4-ylpropylamino)-3-oxoprop-1-en-2-yl]thiophene-2-carboxamide |
| SMILES | COc1ccc(C=C(NC(=O)c2cccs2)C(=O)NCCCN2CCOCC2)cc1OC |
| InChI | InChI=1S/C23H29N3O5S/c1-29-19-7-6-17(16-20(19)30-2)15-18(25-23(28)21-5-3-14-32-21)22(27)24-8-4-9-26-10-12-31-13-11-26/h3,5-7,14-16H,4,8-13H2,1-2H3,(H,24,27)(H,25,28) |
| InChIKey | MDEKBIRWCJADEE-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.57 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|