C18H16F3N3O4 — CID 5024295
3-(furan-2-yl)-1-[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]prop-2-en-1-one (PubChem CID 5024295) has the molecular formula C18H16F3N3O4 and a molecular weight of 395.34 g/mol. Its IUPAC name is 3-(furan-2-yl)-1-[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]prop-2-en-1-one.
| Compound Name | 3-(furan-2-yl)-1-[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 5024295 |
| Molecular Formula | C18H16F3N3O4 |
| Molecular Weight | 395.34 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | 3-(furan-2-yl)-1-[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]prop-2-en-1-one |
| SMILES | O=C(C=Cc1ccco1)N1CCN(c2ccc(C(F)(F)F)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C18H16F3N3O4/c19-18(20,21)13-3-5-15(16(12-13)24(26)27)22-7-9-23(10-8-22)17(25)6-4-14-2-1-11-28-14/h1-6,11-12H,7-10H2 |
| InChIKey | KTGIYBWMDKCJKW-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 79.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.34 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|