C22H21F3N4O4 — CID 46556428
N-methyl-4-[(E)-3-[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]-3-oxoprop-1-enyl]benzamide (PubChem CID 46556428) has the molecular formula C22H21F3N4O4 and a molecular weight of 462.43 g/mol. Its IUPAC name is N-methyl-4-[(E)-3-[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]-3-oxoprop-1-enyl]benzamide.
| Compound Name | N-methyl-4-[(E)-3-[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]-3-oxoprop-1-enyl]benzamide |
|---|---|
| PubChem CID | 46556428 |
| Molecular Formula | C22H21F3N4O4 |
| Molecular Weight | 462.43 g/mol |
| Exact Mass | 462.15 |
| IUPAC Name | N-methyl-4-[(E)-3-[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]-3-oxoprop-1-enyl]benzamide |
| SMILES | CNC(=O)c1ccc(/C=C/C(=O)N2CCN(c3ccc(C(F)(F)F)cc3[N+](=O)[O-])CC2)cc1 |
| InChI | InChI=1S/C22H21F3N4O4/c1-26-21(31)16-5-2-15(3-6-16)4-9-20(30)28-12-10-27(11-13-28)18-8-7-17(22(23,24)25)14-19(18)29(32)33/h2-9,14H,10-13H2,1H3,(H,26,31)/b9-4+ |
| InChIKey | HFYFQUFEUZHGKQ-RUDMXATFSA-N |
| XLogP | 3.34 |
| TPSA | 95.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.43 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|