C26H22N2O5S — CID 5031359
N'-[3-(benzylsulfanylmethyl)-1-benzofuran-2-carbonyl]-2,3-dihydro-1,4-benzodioxine-3-carbohydrazide (PubChem CID 5031359) has the molecular formula C26H22N2O5S and a molecular weight of 474.54 g/mol. Its IUPAC name is N'-[3-(benzylsulfanylmethyl)-1-benzofuran-2-carbonyl]-2,3-dihydro-1,4-benzodioxine-3-carbohydrazide.
| Compound Name | N'-[3-(benzylsulfanylmethyl)-1-benzofuran-2-carbonyl]-2,3-dihydro-1,4-benzodioxine-3-carbohydrazide |
|---|---|
| PubChem CID | 5031359 |
| Molecular Formula | C26H22N2O5S |
| Molecular Weight | 474.54 g/mol |
| Exact Mass | 474.12 |
| IUPAC Name | N'-[3-(benzylsulfanylmethyl)-1-benzofuran-2-carbonyl]-2,3-dihydro-1,4-benzodioxine-3-carbohydrazide |
| SMILES | O=C(NNC(=O)C1COc2ccccc2O1)c1oc2ccccc2c1CSCc1ccccc1 |
| InChI | InChI=1S/C26H22N2O5S/c29-25(23-14-31-21-12-6-7-13-22(21)32-23)27-28-26(30)24-19(18-10-4-5-11-20(18)33-24)16-34-15-17-8-2-1-3-9-17/h1-13,23H,14-16H2,(H,27,29)(H,28,30) |
| InChIKey | QQIVGNPXXLJJCV-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 89.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.54 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|