C21H23NO4 — CID 5032983
[2-(tert-butylamino)-2-oxoethyl] 2-(4-methylbenzoyl)benzoate (PubChem CID 5032983) has the molecular formula C21H23NO4 and a molecular weight of 353.42 g/mol. Its IUPAC name is [2-(tert-butylamino)-2-oxoethyl] 2-(4-methylbenzoyl)benzoate.
| Compound Name | [2-(tert-butylamino)-2-oxoethyl] 2-(4-methylbenzoyl)benzoate |
|---|---|
| PubChem CID | 5032983 |
| Molecular Formula | C21H23NO4 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | [2-(tert-butylamino)-2-oxoethyl] 2-(4-methylbenzoyl)benzoate |
| SMILES | Cc1ccc(C(=O)c2ccccc2C(=O)OCC(=O)NC(C)(C)C)cc1 |
| InChI | InChI=1S/C21H23NO4/c1-14-9-11-15(12-10-14)19(24)16-7-5-6-8-17(16)20(25)26-13-18(23)22-21(2,3)4/h5-12H,13H2,1-4H3,(H,22,23) |
| InChIKey | PAFWWUXBXORWKF-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |