C25H20Cl2N2O5 — CID 5033244
(7-methoxy-2-oxochromen-4-yl)methyl 3-[5-chloro-1-[(2-chlorophenyl)methyl]-3-methylpyrazol-4-yl]prop-2-enoate (PubChem CID 5033244) has the molecular formula C25H20Cl2N2O5 and a molecular weight of 499.35 g/mol. Its IUPAC name is (7-methoxy-2-oxochromen-4-yl)methyl 3-[5-chloro-1-[(2-chlorophenyl)methyl]-3-methylpyrazol-4-yl]prop-2-enoate.
| Compound Name | (7-methoxy-2-oxochromen-4-yl)methyl 3-[5-chloro-1-[(2-chlorophenyl)methyl]-3-methylpyrazol-4-yl]prop-2-enoate |
|---|---|
| PubChem CID | 5033244 |
| Molecular Formula | C25H20Cl2N2O5 |
| Molecular Weight | 499.35 g/mol |
| Exact Mass | 498.07 |
| IUPAC Name | (7-methoxy-2-oxochromen-4-yl)methyl 3-[5-chloro-1-[(2-chlorophenyl)methyl]-3-methylpyrazol-4-yl]prop-2-enoate |
| SMILES | COc1ccc2c(COC(=O)C=Cc3c(C)nn(Cc4ccccc4Cl)c3Cl)cc(=O)oc2c1 |
| InChI | InChI=1S/C25H20Cl2N2O5/c1-15-19(25(27)29(28-15)13-16-5-3-4-6-21(16)26)9-10-23(30)33-14-17-11-24(31)34-22-12-18(32-2)7-8-20(17)22/h3-12H,13-14H2,1-2H3 |
| InChIKey | ADCADIRWMUHEPA-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 83.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.35 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|