C23H28N5O5S+ — CID 5036799
2-[[5-(3,4-dimethoxyphenyl)-4-ethyl-1H-1,2,4-triazol-4-ium-3-yl]sulfanyl]-N-[(3-ethoxy-2-hydroxyphenyl)methylideneamino]acetamide (PubChem CID 5036799) has the molecular formula C23H28N5O5S+ and a molecular weight of 486.57 g/mol. Its IUPAC name is 2-[[5-(3,4-dimethoxyphenyl)-4-ethyl-1H-1,2,4-triazol-4-ium-3-yl]sulfanyl]-N-[(3-ethoxy-2-hydroxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-[[5-(3,4-dimethoxyphenyl)-4-ethyl-1H-1,2,4-triazol-4-ium-3-yl]sulfanyl]-N-[(3-ethoxy-2-hydroxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 5036799 |
| Molecular Formula | C23H28N5O5S+ |
| Molecular Weight | 486.57 g/mol |
| Exact Mass | 486.18 |
| IUPAC Name | 2-[[5-(3,4-dimethoxyphenyl)-4-ethyl-1H-1,2,4-triazol-4-ium-3-yl]sulfanyl]-N-[(3-ethoxy-2-hydroxyphenyl)methylideneamino]acetamide |
| SMILES | CCOc1cccc(C=NNC(=O)CSc2n[nH]c(-c3ccc(OC)c(OC)c3)[n+]2CC)c1O |
| InChI | InChI=1S/C23H27N5O5S/c1-5-28-22(15-10-11-17(31-3)19(12-15)32-4)26-27-23(28)34-14-20(29)25-24-13-16-8-7-9-18(21(16)30)33-6-2/h7-13H,5-6,14H2,1-4H3,(H2,24,25,29,30)/p+1 |
| InChIKey | QWOOTVDMWSLPLB-UHFFFAOYSA-O |
| XLogP | 2.75 |
| TPSA | 121.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.57 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|