C19H31N3O4S2 — CID 503883
9-benzyl-3-methylidene-1,5-bis(methylsulfonyl)-1,5,9-triazacyclododecane (PubChem CID 503883) has the molecular formula C19H31N3O4S2 and a molecular weight of 429.61 g/mol. Its IUPAC name is 9-benzyl-3-methylidene-1,5-bis(methylsulfonyl)-1,5,9-triazacyclododecane.
| Compound Name | 9-benzyl-3-methylidene-1,5-bis(methylsulfonyl)-1,5,9-triazacyclododecane |
|---|---|
| PubChem CID | 503883 |
| Molecular Formula | C19H31N3O4S2 |
| Molecular Weight | 429.61 g/mol |
| Exact Mass | 429.18 |
| IUPAC Name | 9-benzyl-3-methylidene-1,5-bis(methylsulfonyl)-1,5,9-triazacyclododecane |
| SMILES | C=C1CN(S(C)(=O)=O)CCCN(Cc2ccccc2)CCCN(S(C)(=O)=O)C1 |
| InChI | InChI=1S/C19H31N3O4S2/c1-18-15-21(27(2,23)24)13-7-11-20(17-19-9-5-4-6-10-19)12-8-14-22(16-18)28(3,25)26/h4-6,9-10H,1,7-8,11-17H2,2-3H3 |
| InChIKey | BPKARJMBLLNZNW-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.61 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|