C21H27NO4S — CID 5041277
1-[(4-ethoxy-3-methoxyphenyl)-(4-methylthiophen-2-yl)methyl]piperidine-2-carboxylic acid (PubChem CID 5041277) has the molecular formula C21H27NO4S and a molecular weight of 389.52 g/mol. Its IUPAC name is 1-[(4-ethoxy-3-methoxyphenyl)-(4-methylthiophen-2-yl)methyl]piperidine-2-carboxylic acid.
| Compound Name | 1-[(4-ethoxy-3-methoxyphenyl)-(4-methylthiophen-2-yl)methyl]piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 5041277 |
| Molecular Formula | C21H27NO4S |
| Molecular Weight | 389.52 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | 1-[(4-ethoxy-3-methoxyphenyl)-(4-methylthiophen-2-yl)methyl]piperidine-2-carboxylic acid |
| SMILES | CCOc1ccc(C(c2cc(C)cs2)N2CCCCC2C(=O)O)cc1OC |
| InChI | InChI=1S/C21H27NO4S/c1-4-26-17-9-8-15(12-18(17)25-3)20(19-11-14(2)13-27-19)22-10-6-5-7-16(22)21(23)24/h8-9,11-13,16,20H,4-7,10H2,1-3H3,(H,23,24) |
| InChIKey | AFEGGSKTSSJPMQ-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.52 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |