C8H8NO4S- — CID 5046223
2-(2,4-dioxo-3-propyl-1,3-thiazolidin-5-ylidene)acetate (PubChem CID 5046223) has the molecular formula C8H8NO4S- and a molecular weight of 214.22 g/mol. Its IUPAC name is 2-(2,4-dioxo-3-propyl-1,3-thiazolidin-5-ylidene)acetate.
| Compound Name | 2-(2,4-dioxo-3-propyl-1,3-thiazolidin-5-ylidene)acetate |
|---|---|
| PubChem CID | 5046223 |
| Molecular Formula | C8H8NO4S- |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.02 |
| IUPAC Name | 2-(2,4-dioxo-3-propyl-1,3-thiazolidin-5-ylidene)acetate |
| SMILES | CCCN1C(=O)SC(=CC(=O)[O-])C1=O |
| InChI | InChI=1S/C8H9NO4S/c1-2-3-9-7(12)5(4-6(10)11)14-8(9)13/h4H,2-3H2,1H3,(H,10,11)/p-1 |
| InChIKey | AVKQRVWJCAALFZ-UHFFFAOYSA-M |
| XLogP | -0.27 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|