C15H17ClN4O — CID 5046574
N'-[1-(4-chlorophenyl)ethenyl]-5-propan-2-yl-1H-pyrazole-3-carbohydrazide (PubChem CID 5046574) has the molecular formula C15H17ClN4O and a molecular weight of 304.78 g/mol. Its IUPAC name is N'-[1-(4-chlorophenyl)ethenyl]-5-propan-2-yl-1H-pyrazole-3-carbohydrazide.
| Compound Name | N'-[1-(4-chlorophenyl)ethenyl]-5-propan-2-yl-1H-pyrazole-3-carbohydrazide |
|---|---|
| PubChem CID | 5046574 |
| Molecular Formula | C15H17ClN4O |
| Molecular Weight | 304.78 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | N'-[1-(4-chlorophenyl)ethenyl]-5-propan-2-yl-1H-pyrazole-3-carbohydrazide |
| SMILES | C=C(NNC(=O)c1cc(C(C)C)[nH]n1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H17ClN4O/c1-9(2)13-8-14(19-18-13)15(21)20-17-10(3)11-4-6-12(16)7-5-11/h4-9,17H,3H2,1-2H3,(H,18,19)(H,20,21) |
| InChIKey | QEYROFLYAZOVFT-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.78 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|