C17H15N2O2- — CID 5048733
1-(2,4-dimethylphenyl)-2-methylbenzimidazole-5-carboxylate (PubChem CID 5048733) has the molecular formula C17H15N2O2- and a molecular weight of 279.32 g/mol. Its IUPAC name is 1-(2,4-dimethylphenyl)-2-methylbenzimidazole-5-carboxylate.
| Compound Name | 1-(2,4-dimethylphenyl)-2-methylbenzimidazole-5-carboxylate |
|---|---|
| PubChem CID | 5048733 |
| Molecular Formula | C17H15N2O2- |
| Molecular Weight | 279.32 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | 1-(2,4-dimethylphenyl)-2-methylbenzimidazole-5-carboxylate |
| SMILES | Cc1ccc(-n2c(C)nc3cc(C(=O)[O-])ccc32)c(C)c1 |
| InChI | InChI=1S/C17H16N2O2/c1-10-4-6-15(11(2)8-10)19-12(3)18-14-9-13(17(20)21)5-7-16(14)19/h4-9H,1-3H3,(H,20,21)/p-1 |
| InChIKey | NFKMFKQSSTZBMA-UHFFFAOYSA-M |
| XLogP | 2.31 |
| TPSA | 57.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.32 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |