C21H14BrCl2NO4 — CID 504916
4-[N-[(1-bromonaphthalen-2-yl)methyl]-3,4-dichloroanilino]-2,4-dioxobutanoic acid (PubChem CID 504916) has the molecular formula C21H14BrCl2NO4 and a molecular weight of 495.16 g/mol. Its IUPAC name is 4-[N-[(1-bromonaphthalen-2-yl)methyl]-3,4-dichloroanilino]-2,4-dioxobutanoic acid.
| Compound Name | 4-[N-[(1-bromonaphthalen-2-yl)methyl]-3,4-dichloroanilino]-2,4-dioxobutanoic acid |
|---|---|
| PubChem CID | 504916 |
| Molecular Formula | C21H14BrCl2NO4 |
| Molecular Weight | 495.16 g/mol |
| Exact Mass | 492.95 |
| IUPAC Name | 4-[N-[(1-bromonaphthalen-2-yl)methyl]-3,4-dichloroanilino]-2,4-dioxobutanoic acid |
| SMILES | O=C(O)C(=O)CC(=O)N(Cc1ccc2ccccc2c1Br)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C21H14BrCl2NO4/c22-20-13(6-5-12-3-1-2-4-15(12)20)11-25(19(27)10-18(26)21(28)29)14-7-8-16(23)17(24)9-14/h1-9H,10-11H2,(H,28,29) |
| InChIKey | AQMXPAABBDWZLY-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.16 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|